C28H24ClF5N2O5 — CID 134262157
4-[[(2R)-2-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-3-(4,4-difluorocyclohexyl)propanoyl]amino]benzoic acid (PubChem CID 134262157) has the molecular formula C28H24ClF5N2O5 and a molecular weight of 598.95 g/mol. Its IUPAC name is 4-[[(2R)-2-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-3-(4,4-difluorocyclohexyl)propanoyl]amino]benzoic acid.
| Compound Name | 4-[[(2R)-2-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-3-(4,4-difluorocyclohexyl)propanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 134262157 |
| Molecular Formula | C28H24ClF5N2O5 |
| Molecular Weight | 598.95 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | 4-[[(2R)-2-[5-[3-chloro-6-(difluoromethoxy)-2-fluorophenyl]-1-oxidopyridin-1-ium-2-yl]-3-(4,4-difluorocyclohexyl)propanoyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)[C@H](CC2CCC(F)(F)CC2)c2ccc(-c3c(OC(F)F)ccc(Cl)c3F)c[n+]2[O-])cc1 |
| InChI | InChI=1S/C28H24ClF5N2O5/c29-20-6-8-22(41-27(31)32)23(24(20)30)17-3-7-21(36(40)14-17)19(13-15-9-11-28(33,34)12-10-15)25(37)35-18-4-1-16(2-5-18)26(38)39/h1-8,14-15,19,27H,9-13H2,(H,35,37)(H,38,39)/t19-/m1/s1 |
| InChIKey | FYTORULIARDUTO-LJQANCHMSA-N |
| XLogP | 7.02 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.95 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|