C23H20N6O4 — CID 134262442
7-benzyl-8-(5H-[1,3]dioxolo[4,5-f]benzimidazol-6-ylmethyl)-3-ethylpurine-2,6-dione (PubChem CID 134262442) has the molecular formula C23H20N6O4 and a molecular weight of 444.45 g/mol. Its IUPAC name is 7-benzyl-8-(5H-[1,3]dioxolo[4,5-f]benzimidazol-6-ylmethyl)-3-ethylpurine-2,6-dione.
| Compound Name | 7-benzyl-8-(5H-[1,3]dioxolo[4,5-f]benzimidazol-6-ylmethyl)-3-ethylpurine-2,6-dione |
|---|---|
| PubChem CID | 134262442 |
| Molecular Formula | C23H20N6O4 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 7-benzyl-8-(5H-[1,3]dioxolo[4,5-f]benzimidazol-6-ylmethyl)-3-ethylpurine-2,6-dione |
| SMILES | CCn1c(=O)[nH]c(=O)c2c1nc(Cc1nc3cc4c(cc3[nH]1)OCO4)n2Cc1ccccc1 |
| InChI | InChI=1S/C23H20N6O4/c1-2-28-21-20(22(30)27-23(28)31)29(11-13-6-4-3-5-7-13)19(26-21)10-18-24-14-8-16-17(33-12-32-16)9-15(14)25-18/h3-9H,2,10-12H2,1H3,(H,24,25)(H,27,30,31) |
| InChIKey | DKITUBGXJSKLQY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |