About 7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-amine
7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-amine (PubChem CID 134262960) has the molecular formula C9H6BrClF3N3
and a molecular weight of 328.52 g/mol. Its IUPAC name is 7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-amine.
Molecular Properties
| Compound Name | 7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-amine |
| PubChem CID | 134262960 |
| Molecular Formula | C9H6BrClF3N3 |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 326.94 |
| IUPAC Name | 7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-amine |
| SMILES | Nc1nn(CC(F)(F)F)c2c(Br)ccc(Cl)c12 |
| InChI | InChI=1S/C9H6BrClF3N3/c10-4-1-2-5(11)6-7(4)17(16-8(6)15)3-9(12,13)14/h1-2H,3H2,(H2,15,16) |
| InChIKey | WSUZWTPRZQLWHI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-amine?
The IUPAC name of 7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-amine (CID 134262960) is 7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-amine.
What is the SMILES notation for 7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-amine?
The canonical SMILES for 7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-amine is Nc1nn(CC(F)(F)F)c2c(Br)ccc(Cl)c12.
What is the InChIKey of 7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-amine?
The InChIKey is WSUZWTPRZQLWHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrClF3N3/c10-4-1-2-5(11)6-7(4)17(16-8(6)15)3-9(12,13)14/h1-2H,3H2,(H2,15,16).
What are the key properties of 7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-amine?
7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-amine has a molecular weight of 328.52 g/mol, XLogP of 3.60, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-amine is sourced from PubChem (CID 134262960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).