C12H18O3 — CID 13426363
methyl (E)-3-(2,5-dimethyl-3,4-dihydropyran-2-yl)-2-methylprop-2-enoate (PubChem CID 13426363) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is methyl (E)-3-(2,5-dimethyl-3,4-dihydropyran-2-yl)-2-methylprop-2-enoate.
| Compound Name | methyl (E)-3-(2,5-dimethyl-3,4-dihydropyran-2-yl)-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 13426363 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | methyl (E)-3-(2,5-dimethyl-3,4-dihydropyran-2-yl)-2-methylprop-2-enoate |
| SMILES | COC(=O)/C(C)=C/C1(C)CCC(C)=CO1 |
| InChI | InChI=1S/C12H18O3/c1-9-5-6-12(3,15-8-9)7-10(2)11(13)14-4/h7-8H,5-6H2,1-4H3/b10-7+ |
| InChIKey | UNZUNHIIRBTEKX-JXMROGBWSA-N |
| XLogP | 2.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|