C20H13Cl2F2N3O2S — CID 134263772
N-[3-[2-(6-amino-2-methyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-2,5-dichlorobenzenesulfonamide (PubChem CID 134263772) has the molecular formula C20H13Cl2F2N3O2S and a molecular weight of 468.31 g/mol. Its IUPAC name is N-[3-[2-(6-amino-2-methyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-2,5-dichlorobenzenesulfonamide.
| Compound Name | N-[3-[2-(6-amino-2-methyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-2,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 134263772 |
| Molecular Formula | C20H13Cl2F2N3O2S |
| Molecular Weight | 468.31 g/mol |
| Exact Mass | 467.01 |
| IUPAC Name | N-[3-[2-(6-amino-2-methyl-3-pyridinyl)ethynyl]-2,4-difluorophenyl]-2,5-dichlorobenzenesulfonamide |
| SMILES | Cc1nc(N)ccc1C#Cc1c(F)ccc(NS(=O)(=O)c2cc(Cl)ccc2Cl)c1F |
| InChI | InChI=1S/C20H13Cl2F2N3O2S/c1-11-12(3-9-19(25)26-11)2-5-14-16(23)7-8-17(20(14)24)27-30(28,29)18-10-13(21)4-6-15(18)22/h3-4,6-10,27H,1H3,(H2,25,26) |
| InChIKey | BWUFIYWGNSCJFM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.31 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|