C15H20O4 — CID 13426390
(1S,2R,6S,7R)-10-propan-2-ylidenetricyclo[5.2.1.02,6]decane-2,6-dicarboxylic acid (PubChem CID 13426390) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (1S,2R,6S,7R)-10-propan-2-ylidenetricyclo[5.2.1.02,6]decane-2,6-dicarboxylic acid.
| Compound Name | (1S,2R,6S,7R)-10-propan-2-ylidenetricyclo[5.2.1.02,6]decane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 13426390 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (1S,2R,6S,7R)-10-propan-2-ylidenetricyclo[5.2.1.02,6]decane-2,6-dicarboxylic acid |
| SMILES | CC(C)=C1[C@H]2CC[C@@H]1[C@]1(C(=O)O)CCC[C@]21C(=O)O |
| InChI | InChI=1S/C15H20O4/c1-8(2)11-9-4-5-10(11)15(13(18)19)7-3-6-14(9,15)12(16)17/h9-10H,3-7H2,1-2H3,(H,16,17)(H,18,19)/t9-,10+,14-,15+ |
| InChIKey | WHRXLKJQQJHNIF-LMHVJCSRSA-N |
| XLogP | 2.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|