C42H69NO6 — CID 134263962
3-[1,3-bis[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy]propan-2-ylamino]propanoic acid (PubChem CID 134263962) has the molecular formula C42H69NO6 and a molecular weight of 684.02 g/mol. Its IUPAC name is 3-[1,3-bis[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy]propan-2-ylamino]propanoic acid.
| Compound Name | 3-[1,3-bis[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy]propan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 134263962 |
| Molecular Formula | C42H69NO6 |
| Molecular Weight | 684.02 g/mol |
| Exact Mass | 683.51 |
| IUPAC Name | 3-[1,3-bis[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy]propan-2-ylamino]propanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\C/C=C\C/C=C\CC)NCCC(=O)O |
| InChI | InChI=1S/C42H69NO6/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-41(46)48-37-39(43-36-35-40(44)45)38-49-42(47)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,39,43H,3-4,9-10,15-16,21-38H2,1-2H3,(H,44,45)/b7-5-,8-6-,13-11-,14-12-,19-17-,20-18- |
| InChIKey | XEVOQIWNFUAVLG-YTWBPVBXSA-N |
| XLogP | 10.68 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.02 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|