C13H15F3N2O — CID 134264048
(1R,9S)-4-(2,2,2-trifluoroethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 134264048) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is (1R,9S)-4-(2,2,2-trifluoroethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-4-(2,2,2-trifluoroethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 134264048 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | (1R,9S)-4-(2,2,2-trifluoroethyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1cc(CC(F)(F)F)cc2n1C[C@@H]1CNC[C@H]2C1 |
| InChI | InChI=1S/C13H15F3N2O/c14-13(15,16)4-8-2-11-10-1-9(5-17-6-10)7-18(11)12(19)3-8/h2-3,9-10,17H,1,4-7H2/t9-,10+/m0/s1 |
| InChIKey | ROMQYXADXASYDV-VHSXEESVSA-N |
| XLogP | 1.66 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |