C22H19ClN4 — CID 134264197
6-chloro-4-[2-[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenyl]ethynyl]isoquinolin-3-amine (PubChem CID 134264197) has the molecular formula C22H19ClN4 and a molecular weight of 374.88 g/mol. Its IUPAC name is 6-chloro-4-[2-[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenyl]ethynyl]isoquinolin-3-amine.
| Compound Name | 6-chloro-4-[2-[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenyl]ethynyl]isoquinolin-3-amine |
|---|---|
| PubChem CID | 134264197 |
| Molecular Formula | C22H19ClN4 |
| Molecular Weight | 374.88 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 6-chloro-4-[2-[4-(5,5-dimethyl-1,4-dihydroimidazol-2-yl)phenyl]ethynyl]isoquinolin-3-amine |
| SMILES | CC1(C)CN=C(c2ccc(C#Cc3c(N)ncc4ccc(Cl)cc34)cc2)N1 |
| InChI | InChI=1S/C22H19ClN4/c1-22(2)13-26-21(27-22)15-6-3-14(4-7-15)5-10-18-19-11-17(23)9-8-16(19)12-25-20(18)24/h3-4,6-9,11-12H,13H2,1-2H3,(H2,24,25)(H,26,27) |
| InChIKey | ZMGXZDZRPLVDKB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.88 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|