C26H22FN7O2 — CID 134264860
2-[4-[5-amino-1-(1-prop-2-enoylpiperidin-3-yl)imidazo[1,5-c]pyrimidin-3-yl]-2-fluorophenoxy]pyridine-3-carbonitrile (PubChem CID 134264860) has the molecular formula C26H22FN7O2 and a molecular weight of 483.51 g/mol. Its IUPAC name is 2-[4-[5-amino-1-(1-prop-2-enoylpiperidin-3-yl)imidazo[1,5-c]pyrimidin-3-yl]-2-fluorophenoxy]pyridine-3-carbonitrile.
| Compound Name | 2-[4-[5-amino-1-(1-prop-2-enoylpiperidin-3-yl)imidazo[1,5-c]pyrimidin-3-yl]-2-fluorophenoxy]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 134264860 |
| Molecular Formula | C26H22FN7O2 |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 2-[4-[5-amino-1-(1-prop-2-enoylpiperidin-3-yl)imidazo[1,5-c]pyrimidin-3-yl]-2-fluorophenoxy]pyridine-3-carbonitrile |
| SMILES | C=CC(=O)N1CCCC(c2nc(-c3ccc(Oc4ncccc4C#N)c(F)c3)n3c(N)nccc23)C1 |
| InChI | InChI=1S/C26H22FN7O2/c1-2-22(35)33-12-4-6-18(15-33)23-20-9-11-31-26(29)34(20)24(32-23)16-7-8-21(19(27)13-16)36-25-17(14-28)5-3-10-30-25/h2-3,5,7-11,13,18H,1,4,6,12,15H2,(H2,29,31) |
| InChIKey | DMGDPKLJAMWBQW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|