C25H27ClF3N7O2 — CID 134264971
3-chloro-N-ethyl-4-[(3S,4S)-3-methyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]piperidin-1-yl]quinoline-7-carboxamide (PubChem CID 134264971) has the molecular formula C25H27ClF3N7O2 and a molecular weight of 549.99 g/mol. Its IUPAC name is 3-chloro-N-ethyl-4-[(3S,4S)-3-methyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]piperidin-1-yl]quinoline-7-carboxamide.
| Compound Name | 3-chloro-N-ethyl-4-[(3S,4S)-3-methyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]piperidin-1-yl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 134264971 |
| Molecular Formula | C25H27ClF3N7O2 |
| Molecular Weight | 549.99 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 3-chloro-N-ethyl-4-[(3S,4S)-3-methyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]piperidin-1-yl]quinoline-7-carboxamide |
| SMILES | CCNC(=O)c1ccc2c(N3CC[C@H](C(=O)N4CCn5c(nnc5C(F)(F)F)C4)[C@H](C)C3)c(Cl)cnc2c1 |
| InChI | InChI=1S/C25H27ClF3N7O2/c1-3-30-22(37)15-4-5-17-19(10-15)31-11-18(26)21(17)34-7-6-16(14(2)12-34)23(38)35-8-9-36-20(13-35)32-33-24(36)25(27,28)29/h4-5,10-11,14,16H,3,6-9,12-13H2,1-2H3,(H,30,37)/t14-,16+/m1/s1 |
| InChIKey | WCSFQZBUPMCWFF-ZBFHGGJFSA-N |
| XLogP | 3.75 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.99 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |