About 8-methoxy-2,6-diphenylquinazoline
8-methoxy-2,6-diphenylquinazoline (PubChem CID 134265271) has the molecular formula C21H16N2O
and a molecular weight of 312.37 g/mol. Its IUPAC name is 8-methoxy-2,6-diphenylquinazoline.
Molecular Properties
| Compound Name | 8-methoxy-2,6-diphenylquinazoline |
| PubChem CID | 134265271 |
| Molecular Formula | C21H16N2O |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 8-methoxy-2,6-diphenylquinazoline |
| SMILES | COc1cc(-c2ccccc2)cc2cnc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C21H16N2O/c1-24-19-13-17(15-8-4-2-5-9-15)12-18-14-22-21(23-20(18)19)16-10-6-3-7-11-16/h2-14H,1H3 |
| InChIKey | VPGRFVFYSCBAQJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methoxy-2,6-diphenylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-2,6-diphenylquinazoline?
The IUPAC name of 8-methoxy-2,6-diphenylquinazoline (CID 134265271) is 8-methoxy-2,6-diphenylquinazoline.
What is the SMILES notation for 8-methoxy-2,6-diphenylquinazoline?
The canonical SMILES for 8-methoxy-2,6-diphenylquinazoline is COc1cc(-c2ccccc2)cc2cnc(-c3ccccc3)nc12.
What is the InChIKey of 8-methoxy-2,6-diphenylquinazoline?
The InChIKey is VPGRFVFYSCBAQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O/c1-24-19-13-17(15-8-4-2-5-9-15)12-18-14-22-21(23-20(18)19)16-10-6-3-7-11-16/h2-14H,1H3.
What are the key properties of 8-methoxy-2,6-diphenylquinazoline?
8-methoxy-2,6-diphenylquinazoline has a molecular weight of 312.37 g/mol, XLogP of 4.97, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-2,6-diphenylquinazoline is sourced from PubChem (CID 134265271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).