C27H28ClFN2O4S2 — CID 134265296
2-[[5-[(1R,2S)-1-(4-chlorophenyl)-1-(7-fluoro-5-methyl-1H-indol-3-yl)pentan-2-yl]thiophene-2-carbonyl]amino]ethanesulfonic acid (PubChem CID 134265296) has the molecular formula C27H28ClFN2O4S2 and a molecular weight of 563.12 g/mol. Its IUPAC name is 2-[[5-[(1R,2S)-1-(4-chlorophenyl)-1-(7-fluoro-5-methyl-1H-indol-3-yl)pentan-2-yl]thiophene-2-carbonyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[5-[(1R,2S)-1-(4-chlorophenyl)-1-(7-fluoro-5-methyl-1H-indol-3-yl)pentan-2-yl]thiophene-2-carbonyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 134265296 |
| Molecular Formula | C27H28ClFN2O4S2 |
| Molecular Weight | 563.12 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | 2-[[5-[(1R,2S)-1-(4-chlorophenyl)-1-(7-fluoro-5-methyl-1H-indol-3-yl)pentan-2-yl]thiophene-2-carbonyl]amino]ethanesulfonic acid |
| SMILES | CCC[C@H](c1ccc(C(=O)NCCS(=O)(=O)O)s1)[C@H](c1ccc(Cl)cc1)c1c[nH]c2c(F)cc(C)cc12 |
| InChI | InChI=1S/C27H28ClFN2O4S2/c1-3-4-19(23-9-10-24(36-23)27(32)30-11-12-37(33,34)35)25(17-5-7-18(28)8-6-17)21-15-31-26-20(21)13-16(2)14-22(26)29/h5-10,13-15,19,25,31H,3-4,11-12H2,1-2H3,(H,30,32)(H,33,34,35)/t19-,25+/m1/s1 |
| InChIKey | XNKPVKUYHHGRHT-CLOONOSVSA-N |
| XLogP | 6.66 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.12 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|