C15H21N3 — CID 134265615
(6aR)-4-[(E)-but-2-enyl]-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine (PubChem CID 134265615) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is (6aR)-4-[(E)-but-2-enyl]-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine.
| Compound Name | (6aR)-4-[(E)-but-2-enyl]-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine |
|---|---|
| PubChem CID | 134265615 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | (6aR)-4-[(E)-but-2-enyl]-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine |
| SMILES | C/C=C/Cc1ccnc2c1CC[C@@H]1CNCCN21 |
| InChI | InChI=1S/C15H21N3/c1-2-3-4-12-7-8-17-15-14(12)6-5-13-11-16-9-10-18(13)15/h2-3,7-8,13,16H,4-6,9-11H2,1H3/b3-2+/t13-/m1/s1 |
| InChIKey | DFBMYLQGWBNASC-YWVDXFKGSA-N |
| XLogP | 1.92 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|