C16H25N3 — CID 134265622
(6aR)-4-(2,2-dimethylpropyl)-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine (PubChem CID 134265622) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is (6aR)-4-(2,2-dimethylpropyl)-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine.
| Compound Name | (6aR)-4-(2,2-dimethylpropyl)-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine |
|---|---|
| PubChem CID | 134265622 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | (6aR)-4-(2,2-dimethylpropyl)-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine |
| SMILES | CC(C)(C)Cc1ccnc2c1CC[C@@H]1CNCCN21 |
| InChI | InChI=1S/C16H25N3/c1-16(2,3)10-12-6-7-18-15-14(12)5-4-13-11-17-8-9-19(13)15/h6-7,13,17H,4-5,8-11H2,1-3H3/t13-/m1/s1 |
| InChIKey | IGPVFLAKJJQRDS-CYBMUJFWSA-N |
| XLogP | 2.39 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |