C18H20FN3 — CID 134265627
(6aR)-4-[(3-fluorophenyl)methyl]-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine (PubChem CID 134265627) has the molecular formula C18H20FN3 and a molecular weight of 297.38 g/mol. Its IUPAC name is (6aR)-4-[(3-fluorophenyl)methyl]-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine.
| Compound Name | (6aR)-4-[(3-fluorophenyl)methyl]-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine |
|---|---|
| PubChem CID | 134265627 |
| Molecular Formula | C18H20FN3 |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (6aR)-4-[(3-fluorophenyl)methyl]-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine |
| SMILES | Fc1cccc(Cc2ccnc3c2CC[C@@H]2CNCCN32)c1 |
| InChI | InChI=1S/C18H20FN3/c19-15-3-1-2-13(11-15)10-14-6-7-21-18-17(14)5-4-16-12-20-8-9-22(16)18/h1-3,6-7,11,16,20H,4-5,8-10,12H2/t16-/m1/s1 |
| InChIKey | LXJQUSCIXJJMCJ-MRXNPFEDSA-N |
| XLogP | 2.54 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |