C14H21N3O — CID 134265642
(6aR)-4-(2-methoxyethyl)-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine (PubChem CID 134265642) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is (6aR)-4-(2-methoxyethyl)-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine.
| Compound Name | (6aR)-4-(2-methoxyethyl)-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine |
|---|---|
| PubChem CID | 134265642 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | (6aR)-4-(2-methoxyethyl)-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine |
| SMILES | COCCc1ccnc2c1CC[C@@H]1CNCCN21 |
| InChI | InChI=1S/C14H21N3O/c1-18-9-5-11-4-6-16-14-13(11)3-2-12-10-15-7-8-17(12)14/h4,6,12,15H,2-3,5,7-10H2,1H3/t12-/m1/s1 |
| InChIKey | QFCTXPYSZGPYAK-GFCCVEGCSA-N |
| XLogP | 0.99 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |