C20H24BrN3 — CID 134265673
(6aR)-8-benzyl-3-bromo-4-ethyl-5,6,6a,7,9,10-hexahydropyrazino[1,2-a][1,8]naphthyridine (PubChem CID 134265673) has the molecular formula C20H24BrN3 and a molecular weight of 386.34 g/mol. Its IUPAC name is (6aR)-8-benzyl-3-bromo-4-ethyl-5,6,6a,7,9,10-hexahydropyrazino[1,2-a][1,8]naphthyridine.
| Compound Name | (6aR)-8-benzyl-3-bromo-4-ethyl-5,6,6a,7,9,10-hexahydropyrazino[1,2-a][1,8]naphthyridine |
|---|---|
| PubChem CID | 134265673 |
| Molecular Formula | C20H24BrN3 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | (6aR)-8-benzyl-3-bromo-4-ethyl-5,6,6a,7,9,10-hexahydropyrazino[1,2-a][1,8]naphthyridine |
| SMILES | CCc1c(Br)cnc2c1CC[C@@H]1CN(Cc3ccccc3)CCN21 |
| InChI | InChI=1S/C20H24BrN3/c1-2-17-18-9-8-16-14-23(13-15-6-4-3-5-7-15)10-11-24(16)20(18)22-12-19(17)21/h3-7,12,16H,2,8-11,13-14H2,1H3/t16-/m1/s1 |
| InChIKey | IMPOAWAOXWSJEP-MRXNPFEDSA-N |
| XLogP | 4.04 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |