C18H21N3 — CID 134265735
(6aR)-4-benzyl-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,7]naphthyridine (PubChem CID 134265735) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is (6aR)-4-benzyl-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,7]naphthyridine.
| Compound Name | (6aR)-4-benzyl-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,7]naphthyridine |
|---|---|
| PubChem CID | 134265735 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | (6aR)-4-benzyl-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,7]naphthyridine |
| SMILES | c1ccc(Cc2cncc3c2CC[C@@H]2CNCCN32)cc1 |
| InChI | InChI=1S/C18H21N3/c1-2-4-14(5-3-1)10-15-11-20-13-18-17(15)7-6-16-12-19-8-9-21(16)18/h1-5,11,13,16,19H,6-10,12H2/t16-/m1/s1 |
| InChIKey | YEAATRDZIJRTNR-MRXNPFEDSA-N |
| XLogP | 2.40 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |