C20H25N3 — CID 134265745
(6aR)-3-benzyl-4-ethyl-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine (PubChem CID 134265745) has the molecular formula C20H25N3 and a molecular weight of 307.44 g/mol. Its IUPAC name is (6aR)-3-benzyl-4-ethyl-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine.
| Compound Name | (6aR)-3-benzyl-4-ethyl-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine |
|---|---|
| PubChem CID | 134265745 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (6aR)-3-benzyl-4-ethyl-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine |
| SMILES | CCc1c(Cc2ccccc2)cnc2c1CC[C@@H]1CNCCN21 |
| InChI | InChI=1S/C20H25N3/c1-2-18-16(12-15-6-4-3-5-7-15)13-22-20-19(18)9-8-17-14-21-10-11-23(17)20/h3-7,13,17,21H,2,8-12,14H2,1H3/t17-/m1/s1 |
| InChIKey | NZMUSZUGSVODII-QGZVFWFLSA-N |
| XLogP | 2.96 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |