C15H20F3N3 — CID 134265785
(6aR)-8-methyl-4-(3,3,3-trifluoropropyl)-5,6,6a,7,9,10-hexahydropyrazino[1,2-a][1,8]naphthyridine (PubChem CID 134265785) has the molecular formula C15H20F3N3 and a molecular weight of 299.34 g/mol. Its IUPAC name is (6aR)-8-methyl-4-(3,3,3-trifluoropropyl)-5,6,6a,7,9,10-hexahydropyrazino[1,2-a][1,8]naphthyridine.
| Compound Name | (6aR)-8-methyl-4-(3,3,3-trifluoropropyl)-5,6,6a,7,9,10-hexahydropyrazino[1,2-a][1,8]naphthyridine |
|---|---|
| PubChem CID | 134265785 |
| Molecular Formula | C15H20F3N3 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | (6aR)-8-methyl-4-(3,3,3-trifluoropropyl)-5,6,6a,7,9,10-hexahydropyrazino[1,2-a][1,8]naphthyridine |
| SMILES | CN1CCN2c3nccc(CCC(F)(F)F)c3CC[C@@H]2C1 |
| InChI | InChI=1S/C15H20F3N3/c1-20-8-9-21-12(10-20)2-3-13-11(4-6-15(16,17)18)5-7-19-14(13)21/h5,7,12H,2-4,6,8-10H2,1H3/t12-/m1/s1 |
| InChIKey | NKJPAVXIMYLJDE-GFCCVEGCSA-N |
| XLogP | 2.64 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |