C17H25N3O — CID 134265823
(6aR)-4-(oxan-2-ylmethyl)-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine (PubChem CID 134265823) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is (6aR)-4-(oxan-2-ylmethyl)-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine.
| Compound Name | (6aR)-4-(oxan-2-ylmethyl)-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine |
|---|---|
| PubChem CID | 134265823 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (6aR)-4-(oxan-2-ylmethyl)-6,6a,7,8,9,10-hexahydro-5H-pyrazino[1,2-a][1,8]naphthyridine |
| SMILES | c1cc(CC2CCCCO2)c2c(n1)N1CCNC[C@H]1CC2 |
| InChI | InChI=1S/C17H25N3O/c1-2-10-21-15(3-1)11-13-6-7-19-17-16(13)5-4-14-12-18-8-9-20(14)17/h6-7,14-15,18H,1-5,8-12H2/t14-,15?/m1/s1 |
| InChIKey | MMTJSSRLSCOMQV-GICMACPYSA-N |
| XLogP | 1.92 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |