About 2,5-dimethyl-1,4-diazacyclohepta-2,4,6,7-tetraene
2,5-dimethyl-1,4-diazacyclohepta-2,4,6,7-tetraene (PubChem CID 134266095) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 2,5-dimethyl-1,4-diazacyclohepta-2,4,6,7-tetraene.
Analyze 2,5-dimethyl-1,4-diazacyclohepta-2,4,6,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1,4-diazacyclohepta-2,4,6,7-tetraene?
The IUPAC name of 2,5-dimethyl-1,4-diazacyclohepta-2,4,6,7-tetraene (CID 134266095) is 2,5-dimethyl-1,4-diazacyclohepta-2,4,6,7-tetraene.
What is the SMILES notation for 2,5-dimethyl-1,4-diazacyclohepta-2,4,6,7-tetraene?
The canonical SMILES for 2,5-dimethyl-1,4-diazacyclohepta-2,4,6,7-tetraene is CC1=CN=C(C)C=C=N1.
What is the InChIKey of 2,5-dimethyl-1,4-diazacyclohepta-2,4,6,7-tetraene?
The InChIKey is FUTMMDDIZSQCPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2/c1-6-3-4-8-7(2)5-9-6/h3,5H,1-2H3.
What are the key properties of 2,5-dimethyl-1,4-diazacyclohepta-2,4,6,7-tetraene?
2,5-dimethyl-1,4-diazacyclohepta-2,4,6,7-tetraene has a molecular weight of 120.15 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1,4-diazacyclohepta-2,4,6,7-tetraene is sourced from PubChem (CID 134266095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).