C35H21F3N4 — CID 134266138
5',14'-dipyridin-2-yl-2-(trifluoromethyl)spiro[pyrazolo[5,1-a]isoindole-5,2'-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene] (PubChem CID 134266138) has the molecular formula C35H21F3N4 and a molecular weight of 554.58 g/mol. Its IUPAC name is 5',14'-dipyridin-2-yl-2-(trifluoromethyl)spiro[pyrazolo[5,1-a]isoindole-5,2'-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene].
| Compound Name | 5',14'-dipyridin-2-yl-2-(trifluoromethyl)spiro[pyrazolo[5,1-a]isoindole-5,2'-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene] |
|---|---|
| PubChem CID | 134266138 |
| Molecular Formula | C35H21F3N4 |
| Molecular Weight | 554.58 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | 5',14'-dipyridin-2-yl-2-(trifluoromethyl)spiro[pyrazolo[5,1-a]isoindole-5,2'-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene] |
| SMILES | FC(F)(F)c1cc2n(n1)C1(c3cc(-c4ccccn4)ccc3C=Cc3ccc(-c4ccccn4)cc31)c1ccccc1-2 |
| InChI | InChI=1S/C35H21F3N4/c36-35(37,38)33-21-32-26-7-1-2-8-27(26)34(42(32)41-33)28-19-24(30-9-3-5-17-39-30)15-13-22(28)11-12-23-14-16-25(20-29(23)34)31-10-4-6-18-40-31/h1-21H |
| InChIKey | ZFNBKPCENUBKSP-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.58 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|