About 5,5-bis(4-bromophenyl)-2-(trifluoromethyl)pyrazolo[5,1-a]isoindole
5,5-bis(4-bromophenyl)-2-(trifluoromethyl)pyrazolo[5,1-a]isoindole (PubChem CID 134266187) has the molecular formula C23H13Br2F3N2
and a molecular weight of 534.17 g/mol. Its IUPAC name is 5,5-bis(4-bromophenyl)-2-(trifluoromethyl)pyrazolo[5,1-a]isoindole.
Molecular Properties
| Compound Name | 5,5-bis(4-bromophenyl)-2-(trifluoromethyl)pyrazolo[5,1-a]isoindole |
| PubChem CID | 134266187 |
| Molecular Formula | C23H13Br2F3N2 |
| Molecular Weight | 534.17 g/mol |
| Exact Mass | 531.94 |
| IUPAC Name | 5,5-bis(4-bromophenyl)-2-(trifluoromethyl)pyrazolo[5,1-a]isoindole |
| SMILES | FC(F)(F)c1cc2n(n1)C(c1ccc(Br)cc1)(c1ccc(Br)cc1)c1ccccc1-2 |
| InChI | InChI=1S/C23H13Br2F3N2/c24-16-9-5-14(6-10-16)22(15-7-11-17(25)12-8-15)19-4-2-1-3-18(19)20-13-21(23(26,27)28)29-30(20)22/h1-13H |
| InChIKey | SSGHUDDPUGVGTM-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.17 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-bis(4-bromophenyl)-2-(trifluoromethyl)pyrazolo[5,1-a]isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-bis(4-bromophenyl)-2-(trifluoromethyl)pyrazolo[5,1-a]isoindole?
The IUPAC name of 5,5-bis(4-bromophenyl)-2-(trifluoromethyl)pyrazolo[5,1-a]isoindole (CID 134266187) is 5,5-bis(4-bromophenyl)-2-(trifluoromethyl)pyrazolo[5,1-a]isoindole.
What is the SMILES notation for 5,5-bis(4-bromophenyl)-2-(trifluoromethyl)pyrazolo[5,1-a]isoindole?
The canonical SMILES for 5,5-bis(4-bromophenyl)-2-(trifluoromethyl)pyrazolo[5,1-a]isoindole is FC(F)(F)c1cc2n(n1)C(c1ccc(Br)cc1)(c1ccc(Br)cc1)c1ccccc1-2.
What is the InChIKey of 5,5-bis(4-bromophenyl)-2-(trifluoromethyl)pyrazolo[5,1-a]isoindole?
The InChIKey is SSGHUDDPUGVGTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H13Br2F3N2/c24-16-9-5-14(6-10-16)22(15-7-11-17(25)12-8-15)19-4-2-1-3-18(19)20-13-21(23(26,27)28)29-30(20)22/h1-13H.
What are the key properties of 5,5-bis(4-bromophenyl)-2-(trifluoromethyl)pyrazolo[5,1-a]isoindole?
5,5-bis(4-bromophenyl)-2-(trifluoromethyl)pyrazolo[5,1-a]isoindole has a molecular weight of 534.17 g/mol, XLogP of 7.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-bis(4-bromophenyl)-2-(trifluoromethyl)pyrazolo[5,1-a]isoindole is sourced from PubChem (CID 134266187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).