C38H47FN2O3 — CID 134266361
14-(4-fluorophenyl)-2,5,6,10,10,13,17,24-octamethyl-26-oxa-12,13-diazaheptacyclo[22.2.1.02,22.05,21.06,18.09,17.011,15]heptacosa-11,14,20-triene-19,25-dione (PubChem CID 134266361) has the molecular formula C38H47FN2O3 and a molecular weight of 598.80 g/mol. Its IUPAC name is 14-(4-fluorophenyl)-2,5,6,10,10,13,17,24-octamethyl-26-oxa-12,13-diazaheptacyclo[22.2.1.02,22.05,21.06,18.09,17.011,15]heptacosa-11,14,20-triene-19,25-dione.
| Compound Name | 14-(4-fluorophenyl)-2,5,6,10,10,13,17,24-octamethyl-26-oxa-12,13-diazaheptacyclo[22.2.1.02,22.05,21.06,18.09,17.011,15]heptacosa-11,14,20-triene-19,25-dione |
|---|---|
| PubChem CID | 134266361 |
| Molecular Formula | C38H47FN2O3 |
| Molecular Weight | 598.80 g/mol |
| Exact Mass | 598.36 |
| IUPAC Name | 14-(4-fluorophenyl)-2,5,6,10,10,13,17,24-octamethyl-26-oxa-12,13-diazaheptacyclo[22.2.1.02,22.05,21.06,18.09,17.011,15]heptacosa-11,14,20-triene-19,25-dione |
| SMILES | Cn1nc2c(c1-c1ccc(F)cc1)CC1(C)C(CCC3(C)C1C(=O)C=C1C4CC5(C)CC(OC5=O)C4(C)CCC13C)C2(C)C |
| InChI | InChI=1S/C38H47FN2O3/c1-33(2)27-13-14-38(7)30(36(27,5)18-23-29(41(8)40-31(23)33)21-9-11-22(39)12-10-21)26(42)17-24-25-19-34(3)20-28(44-32(34)43)35(25,4)15-16-37(24,38)6/h9-12,17,25,27-28,30H,13-16,18-20H2,1-8H3 |
| InChIKey | FSVHAFOQNJJYIW-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.80 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |