C13H14F2NO5S- — CID 134266434
(5E,6E)-2-(2-carboxyethyl)-3,3-difluoro-5,6-bis(prop-2-enylidene)morpholine-4-sulfinate (PubChem CID 134266434) has the molecular formula C13H14F2NO5S- and a molecular weight of 334.32 g/mol. Its IUPAC name is (5E,6E)-2-(2-carboxyethyl)-3,3-difluoro-5,6-bis(prop-2-enylidene)morpholine-4-sulfinate.
| Compound Name | (5E,6E)-2-(2-carboxyethyl)-3,3-difluoro-5,6-bis(prop-2-enylidene)morpholine-4-sulfinate |
|---|---|
| PubChem CID | 134266434 |
| Molecular Formula | C13H14F2NO5S- |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | (5E,6E)-2-(2-carboxyethyl)-3,3-difluoro-5,6-bis(prop-2-enylidene)morpholine-4-sulfinate |
| SMILES | C=C/C=C1/OC(CCC(=O)O)C(F)(F)N(S(=O)[O-])/C1=C/C=C |
| InChI | InChI=1S/C13H15F2NO5S/c1-3-5-9-10(6-4-2)21-11(7-8-12(17)18)13(14,15)16(9)22(19)20/h3-6,11H,1-2,7-8H2,(H,17,18)(H,19,20)/p-1/b9-5+,10-6+ |
| InChIKey | SCKXLYFWGJNPRL-NXZHAISVSA-M |
| XLogP | 2.08 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|