C11H13NO5S — CID 134266437
(2R,5E,6E)-5,6-bis(prop-2-enylidene)-4-sulfinomorpholine-2-carboxylic acid (PubChem CID 134266437) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is (2R,5E,6E)-5,6-bis(prop-2-enylidene)-4-sulfinomorpholine-2-carboxylic acid.
| Compound Name | (2R,5E,6E)-5,6-bis(prop-2-enylidene)-4-sulfinomorpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 134266437 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | (2R,5E,6E)-5,6-bis(prop-2-enylidene)-4-sulfinomorpholine-2-carboxylic acid |
| SMILES | C=C/C=C1/O[C@@H](C(=O)O)CN(S(=O)O)/C1=C/C=C |
| InChI | InChI=1S/C11H13NO5S/c1-3-5-8-9(6-4-2)17-10(11(13)14)7-12(8)18(15)16/h3-6,10H,1-2,7H2,(H,13,14)(H,15,16)/b8-5+,9-6+/t10-/m1/s1 |
| InChIKey | MIOQNKLDPBTWDF-ZVMXJLBNSA-N |
| XLogP | 1.05 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|