C13H9N3O2 — CID 134266746
13-methyl-5,12-dioxa-7,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),6,8,10,13-heptaen-6-amine (PubChem CID 134266746) has the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. Its IUPAC name is 13-methyl-5,12-dioxa-7,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),6,8,10,13-heptaen-6-amine.
| Compound Name | 13-methyl-5,12-dioxa-7,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),6,8,10,13-heptaen-6-amine |
|---|---|
| PubChem CID | 134266746 |
| Molecular Formula | C13H9N3O2 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 13-methyl-5,12-dioxa-7,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),6,8,10,13-heptaen-6-amine |
| SMILES | CC1=Nc2ccc3c4c(ccc(c24)O1)N=C(N)O3 |
| InChI | InChI=1S/C13H9N3O2/c1-6-15-7-2-5-10-12-8(16-13(14)18-10)3-4-9(17-6)11(7)12/h2-5H,1H3,(H2,14,16) |
| InChIKey | QNBWNDIERYLSIO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |