C8H4F11N — CID 13426686
1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]aziridine (PubChem CID 13426686) has the molecular formula C8H4F11N and a molecular weight of 323.11 g/mol. Its IUPAC name is 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]aziridine.
| Compound Name | 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]aziridine |
|---|---|
| PubChem CID | 13426686 |
| Molecular Formula | C8H4F11N |
| Molecular Weight | 323.11 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]aziridine |
| SMILES | FC(F)(F)C(=C(N1CC1)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H4F11N/c9-5(10,8(17,18)19)4(20-1-2-20)3(6(11,12)13)7(14,15)16/h1-2H2 |
| InChIKey | LQDZDGQALBVBKB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.11 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|