About N-[2-[(1Z)-buta-1,3-dienyl]-3-ethenylimidazol-4-yl]formamide
N-[2-[(1Z)-buta-1,3-dienyl]-3-ethenylimidazol-4-yl]formamide (PubChem CID 134266957) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is N-[2-[(1Z)-buta-1,3-dienyl]-3-ethenylimidazol-4-yl]formamide.
Molecular Properties
| Compound Name | N-[2-[(1Z)-buta-1,3-dienyl]-3-ethenylimidazol-4-yl]formamide |
| PubChem CID | 134266957 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | N-[2-[(1Z)-buta-1,3-dienyl]-3-ethenylimidazol-4-yl]formamide |
| SMILES | C=C/C=C\c1ncc(NC=O)n1C=C |
| InChI | InChI=1S/C10H11N3O/c1-3-5-6-9-11-7-10(12-8-14)13(9)4-2/h3-8H,1-2H2,(H,12,14)/b6-5- |
| InChIKey | FQCUFISSCYMVJC-WAYWQWQTSA-N |
| XLogP | 1.75 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(1Z)-buta-1,3-dienyl]-3-ethenylimidazol-4-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(1Z)-buta-1,3-dienyl]-3-ethenylimidazol-4-yl]formamide?
The IUPAC name of N-[2-[(1Z)-buta-1,3-dienyl]-3-ethenylimidazol-4-yl]formamide (CID 134266957) is N-[2-[(1Z)-buta-1,3-dienyl]-3-ethenylimidazol-4-yl]formamide.
What is the SMILES notation for N-[2-[(1Z)-buta-1,3-dienyl]-3-ethenylimidazol-4-yl]formamide?
The canonical SMILES for N-[2-[(1Z)-buta-1,3-dienyl]-3-ethenylimidazol-4-yl]formamide is C=C/C=C\c1ncc(NC=O)n1C=C.
What is the InChIKey of N-[2-[(1Z)-buta-1,3-dienyl]-3-ethenylimidazol-4-yl]formamide?
The InChIKey is FQCUFISSCYMVJC-WAYWQWQTSA-N. The full InChI is InChI=1S/C10H11N3O/c1-3-5-6-9-11-7-10(12-8-14)13(9)4-2/h3-8H,1-2H2,(H,12,14)/b6-5-.
What are the key properties of N-[2-[(1Z)-buta-1,3-dienyl]-3-ethenylimidazol-4-yl]formamide?
N-[2-[(1Z)-buta-1,3-dienyl]-3-ethenylimidazol-4-yl]formamide has a molecular weight of 189.22 g/mol, XLogP of 1.75, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(1Z)-buta-1,3-dienyl]-3-ethenylimidazol-4-yl]formamide is sourced from PubChem (CID 134266957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).