C28H36N2O4S — CID 134267962
(2R)-2-[[[3-[(3E,4Z)-3-ethylidenehepta-4,6-dien-1-ynyl]benzoyl]-propylcarbamoyl]amino]-3-(3-methylbutylsulfanyl)propanoic acid (PubChem CID 134267962) has the molecular formula C28H36N2O4S and a molecular weight of 496.67 g/mol. Its IUPAC name is (2R)-2-[[[3-[(3E,4Z)-3-ethylidenehepta-4,6-dien-1-ynyl]benzoyl]-propylcarbamoyl]amino]-3-(3-methylbutylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-[[[3-[(3E,4Z)-3-ethylidenehepta-4,6-dien-1-ynyl]benzoyl]-propylcarbamoyl]amino]-3-(3-methylbutylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 134267962 |
| Molecular Formula | C28H36N2O4S |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | (2R)-2-[[[3-[(3E,4Z)-3-ethylidenehepta-4,6-dien-1-ynyl]benzoyl]-propylcarbamoyl]amino]-3-(3-methylbutylsulfanyl)propanoic acid |
| SMILES | C=C/C=C\C(C#Cc1cccc(C(=O)N(CCC)C(=O)N[C@@H](CSCCC(C)C)C(=O)O)c1)=C/C |
| InChI | InChI=1S/C28H36N2O4S/c1-6-9-11-22(8-3)14-15-23-12-10-13-24(19-23)26(31)30(17-7-2)28(34)29-25(27(32)33)20-35-18-16-21(4)5/h6,8-13,19,21,25H,1,7,16-18,20H2,2-5H3,(H,29,34)(H,32,33)/b11-9-,22-8+/t25-/m0/s1 |
| InChIKey | XMJQUICOLMPZSY-NQDTYKNPSA-N |
| XLogP | 5.52 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|