C28H41NO — CID 134268318
(3E,5Z)-3-ethoxy-N,2-dimethyl-N-[(3Z,5Z)-5-methyl-6-(4-methylcyclohepta-1,3,5-trien-1-yl)hepta-1,3,5-trien-2-yl]octa-3,5-dien-1-amine (PubChem CID 134268318) has the molecular formula C28H41NO and a molecular weight of 407.64 g/mol. Its IUPAC name is (3E,5Z)-3-ethoxy-N,2-dimethyl-N-[(3Z,5Z)-5-methyl-6-(4-methylcyclohepta-1,3,5-trien-1-yl)hepta-1,3,5-trien-2-yl]octa-3,5-dien-1-amine.
| Compound Name | (3E,5Z)-3-ethoxy-N,2-dimethyl-N-[(3Z,5Z)-5-methyl-6-(4-methylcyclohepta-1,3,5-trien-1-yl)hepta-1,3,5-trien-2-yl]octa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 134268318 |
| Molecular Formula | C28H41NO |
| Molecular Weight | 407.64 g/mol |
| Exact Mass | 407.32 |
| IUPAC Name | (3E,5Z)-3-ethoxy-N,2-dimethyl-N-[(3Z,5Z)-5-methyl-6-(4-methylcyclohepta-1,3,5-trien-1-yl)hepta-1,3,5-trien-2-yl]octa-3,5-dien-1-amine |
| SMILES | C=C(/C=C\C(C)=C(\C)C1=CC=C(C)C=CC1)N(C)CC(C)/C(=C\C=C/CC)OCC |
| InChI | InChI=1S/C28H41NO/c1-9-11-12-16-28(30-10-2)24(5)21-29(8)25(6)19-18-23(4)26(7)27-15-13-14-22(3)17-20-27/h11-14,16-20,24H,6,9-10,15,21H2,1-5,7-8H3/b12-11-,19-18-,26-23-,28-16+ |
| InChIKey | DBEUYAKPKNRVHO-UIFZBQBTSA-N |
| XLogP | 7.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.64 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|