C28H43NO — CID 134268359
(3Z,5Z,7E,9Z)-N-[(2E,3Z,5E)-3-ethyl-2-ethylidene-6-methoxyhepta-3,5-dienyl]-5,6,7,10-tetramethyldodeca-1,3,5,7,9-pentaen-2-amine (PubChem CID 134268359) has the molecular formula C28H43NO and a molecular weight of 409.66 g/mol. Its IUPAC name is (3Z,5Z,7E,9Z)-N-[(2E,3Z,5E)-3-ethyl-2-ethylidene-6-methoxyhepta-3,5-dienyl]-5,6,7,10-tetramethyldodeca-1,3,5,7,9-pentaen-2-amine.
| Compound Name | (3Z,5Z,7E,9Z)-N-[(2E,3Z,5E)-3-ethyl-2-ethylidene-6-methoxyhepta-3,5-dienyl]-5,6,7,10-tetramethyldodeca-1,3,5,7,9-pentaen-2-amine |
|---|---|
| PubChem CID | 134268359 |
| Molecular Formula | C28H43NO |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 409.33 |
| IUPAC Name | (3Z,5Z,7E,9Z)-N-[(2E,3Z,5E)-3-ethyl-2-ethylidene-6-methoxyhepta-3,5-dienyl]-5,6,7,10-tetramethyldodeca-1,3,5,7,9-pentaen-2-amine |
| SMILES | C=C(/C=C\C(C)=C(C)/C(C)=C/C=C(/C)CC)NCC(=C/C)/C(=C\C=C(/C)OC)CC |
| InChI | InChI=1S/C28H43NO/c1-11-21(4)14-15-22(5)26(9)23(6)16-17-24(7)29-20-28(13-3)27(12-2)19-18-25(8)30-10/h13-19,29H,7,11-12,20H2,1-6,8-10H3/b17-16-,21-14-,22-15+,25-18+,26-23-,27-19-,28-13- |
| InChIKey | KZVREYZCPXOQMH-YTVHLIBJSA-N |
| XLogP | 8.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|