C13H23N — CID 134268678
(2E,4Z)-N,4-dimethyl-2-[(Z)-prop-1-enyl]octa-2,4-dien-1-amine (PubChem CID 134268678) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (2E,4Z)-N,4-dimethyl-2-[(Z)-prop-1-enyl]octa-2,4-dien-1-amine.
| Compound Name | (2E,4Z)-N,4-dimethyl-2-[(Z)-prop-1-enyl]octa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 134268678 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (2E,4Z)-N,4-dimethyl-2-[(Z)-prop-1-enyl]octa-2,4-dien-1-amine |
| SMILES | C/C=C\C(=C/C(C)=C\CCC)CNC |
| InChI | InChI=1S/C13H23N/c1-5-7-9-12(3)10-13(8-6-2)11-14-4/h6,8-10,14H,5,7,11H2,1-4H3/b8-6-,12-9-,13-10+ |
| InChIKey | QIZZILYFAKPDIQ-BUBKNYOGSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|