C18H18O8 — CID 134268797
benzyl 2-(2,3,4,5,6-pentahydroxybenzoyl)butanoate (PubChem CID 134268797) has the molecular formula C18H18O8 and a molecular weight of 362.33 g/mol. Its IUPAC name is benzyl 2-(2,3,4,5,6-pentahydroxybenzoyl)butanoate.
| Compound Name | benzyl 2-(2,3,4,5,6-pentahydroxybenzoyl)butanoate |
|---|---|
| PubChem CID | 134268797 |
| Molecular Formula | C18H18O8 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | benzyl 2-(2,3,4,5,6-pentahydroxybenzoyl)butanoate |
| SMILES | CCC(C(=O)OCc1ccccc1)C(=O)c1c(O)c(O)c(O)c(O)c1O |
| InChI | InChI=1S/C18H18O8/c1-2-10(18(25)26-8-9-6-4-3-5-7-9)12(19)11-13(20)15(22)17(24)16(23)14(11)21/h3-7,10,20-24H,2,8H2,1H3 |
| InChIKey | BYAJCTVKTNFRET-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|