C11H20N4 — CID 134269234
(2Z,3Z)-N,5-dimethyl-4-(2-methylhydrazinyl)-2-[(methylideneamino)methylidene]hexa-3,5-dien-1-amine (PubChem CID 134269234) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is (2Z,3Z)-N,5-dimethyl-4-(2-methylhydrazinyl)-2-[(methylideneamino)methylidene]hexa-3,5-dien-1-amine.
| Compound Name | (2Z,3Z)-N,5-dimethyl-4-(2-methylhydrazinyl)-2-[(methylideneamino)methylidene]hexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 134269234 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | (2Z,3Z)-N,5-dimethyl-4-(2-methylhydrazinyl)-2-[(methylideneamino)methylidene]hexa-3,5-dien-1-amine |
| SMILES | C=N/C=C(/C=C(\NNC)C(=C)C)CNC |
| InChI | InChI=1S/C11H20N4/c1-9(2)11(15-14-5)6-10(7-12-3)8-13-4/h6-7,13-15H,1,3,8H2,2,4-5H3/b10-7-,11-6- |
| InChIKey | DWHAGGLAMRWLNE-LXQMTTSMSA-N |
| XLogP | 0.97 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|