C23H17N5S — CID 134269731
5,10-bis(2-methyl-1H-imidazol-5-yl)phenanthro[9,10-d][1,2]thiazole (PubChem CID 134269731) has the molecular formula C23H17N5S and a molecular weight of 395.49 g/mol. Its IUPAC name is 5,10-bis(2-methyl-1H-imidazol-5-yl)phenanthro[9,10-d][1,2]thiazole.
| Compound Name | 5,10-bis(2-methyl-1H-imidazol-5-yl)phenanthro[9,10-d][1,2]thiazole |
|---|---|
| PubChem CID | 134269731 |
| Molecular Formula | C23H17N5S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 5,10-bis(2-methyl-1H-imidazol-5-yl)phenanthro[9,10-d][1,2]thiazole |
| SMILES | Cc1ncc(-c2ccc3c(c2)c2cnsc2c2cc(-c4cnc(C)[nH]4)ccc32)[nH]1 |
| InChI | InChI=1S/C23H17N5S/c1-12-24-10-21(27-12)14-3-5-16-17-6-4-15(22-11-25-13(2)28-22)8-19(17)23-20(9-26-29-23)18(16)7-14/h3-11H,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | FHGVRCQYYIZSEF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|