About N-[(2R)-but-3-en-2-yl]-N-methyl-4-methylsulfanyl-1,1-dioxothian-4-amine
N-[(2R)-but-3-en-2-yl]-N-methyl-4-methylsulfanyl-1,1-dioxothian-4-amine (PubChem CID 134269864) has the molecular formula C11H21NO2S2
and a molecular weight of 263.43 g/mol. Its IUPAC name is N-[(2R)-but-3-en-2-yl]-N-methyl-4-methylsulfanyl-1,1-dioxothian-4-amine.
Molecular Properties
| Compound Name | N-[(2R)-but-3-en-2-yl]-N-methyl-4-methylsulfanyl-1,1-dioxothian-4-amine |
| PubChem CID | 134269864 |
| Molecular Formula | C11H21NO2S2 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | N-[(2R)-but-3-en-2-yl]-N-methyl-4-methylsulfanyl-1,1-dioxothian-4-amine |
| SMILES | C=C[C@@H](C)N(C)C1(SC)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H21NO2S2/c1-5-10(2)12(3)11(15-4)6-8-16(13,14)9-7-11/h5,10H,1,6-9H2,2-4H3/t10-/m1/s1 |
| InChIKey | OJGQUWPSRUXHDN-SNVBAGLBSA-N |
| XLogP | 1.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2R)-but-3-en-2-yl]-N-methyl-4-methylsulfanyl-1,1-dioxothian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-but-3-en-2-yl]-N-methyl-4-methylsulfanyl-1,1-dioxothian-4-amine?
The IUPAC name of N-[(2R)-but-3-en-2-yl]-N-methyl-4-methylsulfanyl-1,1-dioxothian-4-amine (CID 134269864) is N-[(2R)-but-3-en-2-yl]-N-methyl-4-methylsulfanyl-1,1-dioxothian-4-amine.
What is the SMILES notation for N-[(2R)-but-3-en-2-yl]-N-methyl-4-methylsulfanyl-1,1-dioxothian-4-amine?
The canonical SMILES for N-[(2R)-but-3-en-2-yl]-N-methyl-4-methylsulfanyl-1,1-dioxothian-4-amine is C=C[C@@H](C)N(C)C1(SC)CCS(=O)(=O)CC1.
What is the InChIKey of N-[(2R)-but-3-en-2-yl]-N-methyl-4-methylsulfanyl-1,1-dioxothian-4-amine?
The InChIKey is OJGQUWPSRUXHDN-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H21NO2S2/c1-5-10(2)12(3)11(15-4)6-8-16(13,14)9-7-11/h5,10H,1,6-9H2,2-4H3/t10-/m1/s1.
What are the key properties of N-[(2R)-but-3-en-2-yl]-N-methyl-4-methylsulfanyl-1,1-dioxothian-4-amine?
N-[(2R)-but-3-en-2-yl]-N-methyl-4-methylsulfanyl-1,1-dioxothian-4-amine has a molecular weight of 263.43 g/mol, XLogP of 1.76, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-but-3-en-2-yl]-N-methyl-4-methylsulfanyl-1,1-dioxothian-4-amine is sourced from PubChem (CID 134269864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).