About (2R)-N-(2,2-difluoropropyl)-N-methylbut-3-en-2-amine
(2R)-N-(2,2-difluoropropyl)-N-methylbut-3-en-2-amine (PubChem CID 134269934) has the molecular formula C8H15F2N
and a molecular weight of 163.21 g/mol. Its IUPAC name is (2R)-N-(2,2-difluoropropyl)-N-methylbut-3-en-2-amine.
Molecular Properties
| Compound Name | (2R)-N-(2,2-difluoropropyl)-N-methylbut-3-en-2-amine |
| PubChem CID | 134269934 |
| Molecular Formula | C8H15F2N |
| Molecular Weight | 163.21 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | (2R)-N-(2,2-difluoropropyl)-N-methylbut-3-en-2-amine |
| SMILES | C=C[C@@H](C)N(C)CC(C)(F)F |
| InChI | InChI=1S/C8H15F2N/c1-5-7(2)11(4)6-8(3,9)10/h5,7H,1,6H2,2-4H3/t7-/m1/s1 |
| InChIKey | YRHPNWVTRWLMBU-SSDOTTSWSA-N |
| XLogP | 2.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N-(2,2-difluoropropyl)-N-methylbut-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-(2,2-difluoropropyl)-N-methylbut-3-en-2-amine?
The IUPAC name of (2R)-N-(2,2-difluoropropyl)-N-methylbut-3-en-2-amine (CID 134269934) is (2R)-N-(2,2-difluoropropyl)-N-methylbut-3-en-2-amine.
What is the SMILES notation for (2R)-N-(2,2-difluoropropyl)-N-methylbut-3-en-2-amine?
The canonical SMILES for (2R)-N-(2,2-difluoropropyl)-N-methylbut-3-en-2-amine is C=C[C@@H](C)N(C)CC(C)(F)F.
What is the InChIKey of (2R)-N-(2,2-difluoropropyl)-N-methylbut-3-en-2-amine?
The InChIKey is YRHPNWVTRWLMBU-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H15F2N/c1-5-7(2)11(4)6-8(3,9)10/h5,7H,1,6H2,2-4H3/t7-/m1/s1.
What are the key properties of (2R)-N-(2,2-difluoropropyl)-N-methylbut-3-en-2-amine?
(2R)-N-(2,2-difluoropropyl)-N-methylbut-3-en-2-amine has a molecular weight of 163.21 g/mol, XLogP of 2.15, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-(2,2-difluoropropyl)-N-methylbut-3-en-2-amine is sourced from PubChem (CID 134269934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).