C23H42N4 — CID 134270272
2-[[(3E,5Z)-2-(diethylamino)-3-ethenylhepta-3,5-dienyl]amino]-N-ethyl-N'-[(Z)-hex-3-enyl]ethanimidamide (PubChem CID 134270272) has the molecular formula C23H42N4 and a molecular weight of 374.62 g/mol. Its IUPAC name is 2-[[(3E,5Z)-2-(diethylamino)-3-ethenylhepta-3,5-dienyl]amino]-N-ethyl-N'-[(Z)-hex-3-enyl]ethanimidamide.
| Compound Name | 2-[[(3E,5Z)-2-(diethylamino)-3-ethenylhepta-3,5-dienyl]amino]-N-ethyl-N'-[(Z)-hex-3-enyl]ethanimidamide |
|---|---|
| PubChem CID | 134270272 |
| Molecular Formula | C23H42N4 |
| Molecular Weight | 374.62 g/mol |
| Exact Mass | 374.34 |
| IUPAC Name | 2-[[(3E,5Z)-2-(diethylamino)-3-ethenylhepta-3,5-dienyl]amino]-N-ethyl-N'-[(Z)-hex-3-enyl]ethanimidamide |
| SMILES | C=C/C(=C\C=C/C)C(CNC/C(=N/CC/C=C\CC)NCC)N(CC)CC |
| InChI | InChI=1S/C23H42N4/c1-7-13-15-16-18-26-23(25-10-4)20-24-19-22(27(11-5)12-6)21(9-3)17-14-8-2/h8-9,13-15,17,22,24H,3,7,10-12,16,18-20H2,1-2,4-6H3,(H,25,26)/b14-8-,15-13-,21-17+ |
| InChIKey | UVIGCLRFVLQACP-ZXDUXRCOSA-N |
| XLogP | 4.34 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|