C27H42N2 — CID 134270331
N,2-dimethyl-N-[[4-[(2Z)-1,5,8-trimethyl-5-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclooct-2-en-1-yl]-3,4-dihydro-2H-pyrrol-5-yl]methyl]prop-2-en-1-amine (PubChem CID 134270331) has the molecular formula C27H42N2 and a molecular weight of 394.65 g/mol. Its IUPAC name is N,2-dimethyl-N-[[4-[(2Z)-1,5,8-trimethyl-5-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclooct-2-en-1-yl]-3,4-dihydro-2H-pyrrol-5-yl]methyl]prop-2-en-1-amine.
| Compound Name | N,2-dimethyl-N-[[4-[(2Z)-1,5,8-trimethyl-5-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclooct-2-en-1-yl]-3,4-dihydro-2H-pyrrol-5-yl]methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 134270331 |
| Molecular Formula | C27H42N2 |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | N,2-dimethyl-N-[[4-[(2Z)-1,5,8-trimethyl-5-[(1Z)-3-methylidenepenta-1,4-dienyl]cyclooct-2-en-1-yl]-3,4-dihydro-2H-pyrrol-5-yl]methyl]prop-2-en-1-amine |
| SMILES | C=CC(=C)/C=C\C1(C)C/C=C\C(C)(C2CCN=C2CN(C)CC(=C)C)C(C)CC1 |
| InChI | InChI=1S/C27H42N2/c1-9-22(4)11-16-26(6)14-10-15-27(7,23(5)12-17-26)24-13-18-28-25(24)20-29(8)19-21(2)3/h9-11,15-16,23-24H,1-2,4,12-14,17-20H2,3,5-8H3/b15-10-,16-11- |
| InChIKey | KHBJFQNDIRBDPJ-XCMCHEKJSA-N |
| XLogP | 6.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|