C25H43N3 — CID 134270356
(3S,4E,6Z)-3-(but-1-en-2-ylamino)-N-[(3Z,7Z)-deca-3,7-dien-2-yl]-N',4-dimethylnona-4,6-dienimidamide (PubChem CID 134270356) has the molecular formula C25H43N3 and a molecular weight of 385.64 g/mol. Its IUPAC name is (3S,4E,6Z)-3-(but-1-en-2-ylamino)-N-[(3Z,7Z)-deca-3,7-dien-2-yl]-N',4-dimethylnona-4,6-dienimidamide.
| Compound Name | (3S,4E,6Z)-3-(but-1-en-2-ylamino)-N-[(3Z,7Z)-deca-3,7-dien-2-yl]-N',4-dimethylnona-4,6-dienimidamide |
|---|---|
| PubChem CID | 134270356 |
| Molecular Formula | C25H43N3 |
| Molecular Weight | 385.64 g/mol |
| Exact Mass | 385.35 |
| IUPAC Name | (3S,4E,6Z)-3-(but-1-en-2-ylamino)-N-[(3Z,7Z)-deca-3,7-dien-2-yl]-N',4-dimethylnona-4,6-dienimidamide |
| SMILES | C=C(CC)N[C@@H](C/C(=N/C)NC(C)/C=C\CC/C=C\CC)/C(C)=C/C=C\CC |
| InChI | InChI=1S/C25H43N3/c1-8-11-13-14-15-17-19-23(6)28-25(26-7)20-24(27-22(5)10-3)21(4)18-16-12-9-2/h11-13,16-19,23-24,27H,5,8-10,14-15,20H2,1-4,6-7H3,(H,26,28)/b13-11-,16-12-,19-17-,21-18+/t23?,24-/m0/s1 |
| InChIKey | DOLQBSGWOSUMKZ-DUNYJIISSA-N |
| XLogP | 6.48 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.64 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|