C22H36N2 — CID 134270411
N-[(Z,4E)-4-[2-(4,4-dimethylcyclobut-2-en-1-yl)ethylidene]-7-methyl-6-methylideneoct-2-enyl]-N'-methylpropanimidamide (PubChem CID 134270411) has the molecular formula C22H36N2 and a molecular weight of 328.54 g/mol. Its IUPAC name is N-[(Z,4E)-4-[2-(4,4-dimethylcyclobut-2-en-1-yl)ethylidene]-7-methyl-6-methylideneoct-2-enyl]-N'-methylpropanimidamide.
| Compound Name | N-[(Z,4E)-4-[2-(4,4-dimethylcyclobut-2-en-1-yl)ethylidene]-7-methyl-6-methylideneoct-2-enyl]-N'-methylpropanimidamide |
|---|---|
| PubChem CID | 134270411 |
| Molecular Formula | C22H36N2 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.29 |
| IUPAC Name | N-[(Z,4E)-4-[2-(4,4-dimethylcyclobut-2-en-1-yl)ethylidene]-7-methyl-6-methylideneoct-2-enyl]-N'-methylpropanimidamide |
| SMILES | C=C(CC(/C=C\CN/C(CC)=N/C)=C\CC1C=CC1(C)C)C(C)C |
| InChI | InChI=1S/C22H36N2/c1-8-21(23-7)24-15-9-10-19(16-18(4)17(2)3)11-12-20-13-14-22(20,5)6/h9-11,13-14,17,20H,4,8,12,15-16H2,1-3,5-7H3,(H,23,24)/b10-9-,19-11- |
| InChIKey | QOOXWUAMNHGGGU-PZDCBAJESA-N |
| XLogP | 5.70 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|