C23H40N4 — CID 134270424
N-[2-[(Z)-but-1-enyl]cyclopropyl]-N'-methyl-2-[[(4E,6Z)-4-methyl-3-(methylamino)octa-1,4,6-trien-2-yl]-propylamino]ethanimidamide (PubChem CID 134270424) has the molecular formula C23H40N4 and a molecular weight of 372.60 g/mol. Its IUPAC name is N-[2-[(Z)-but-1-enyl]cyclopropyl]-N'-methyl-2-[[(4E,6Z)-4-methyl-3-(methylamino)octa-1,4,6-trien-2-yl]-propylamino]ethanimidamide.
| Compound Name | N-[2-[(Z)-but-1-enyl]cyclopropyl]-N'-methyl-2-[[(4E,6Z)-4-methyl-3-(methylamino)octa-1,4,6-trien-2-yl]-propylamino]ethanimidamide |
|---|---|
| PubChem CID | 134270424 |
| Molecular Formula | C23H40N4 |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.33 |
| IUPAC Name | N-[2-[(Z)-but-1-enyl]cyclopropyl]-N'-methyl-2-[[(4E,6Z)-4-methyl-3-(methylamino)octa-1,4,6-trien-2-yl]-propylamino]ethanimidamide |
| SMILES | C=C(C(NC)/C(C)=C/C=C\C)N(CCC)C/C(=N\C)NC1CC1/C=C\CC |
| InChI | InChI=1S/C23H40N4/c1-8-11-13-18(4)23(25-7)19(5)27(15-10-3)17-22(24-6)26-21-16-20(21)14-12-9-2/h8,11-14,20-21,23,25H,5,9-10,15-17H2,1-4,6-7H3,(H,24,26)/b11-8-,14-12-,18-13+ |
| InChIKey | BVFNCLJQHBCLKF-HIGVVNHMSA-N |
| XLogP | 4.30 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|