C22H38N2 — CID 134270499
1,4,4-trimethyl-10-[(1Z,3Z)-5-methylhexa-1,3-dienyl]-2-propyl-1,3-diazacycloundeca-2,8-diene (PubChem CID 134270499) has the molecular formula C22H38N2 and a molecular weight of 330.56 g/mol. Its IUPAC name is 1,4,4-trimethyl-10-[(1Z,3Z)-5-methylhexa-1,3-dienyl]-2-propyl-1,3-diazacycloundeca-2,8-diene.
| Compound Name | 1,4,4-trimethyl-10-[(1Z,3Z)-5-methylhexa-1,3-dienyl]-2-propyl-1,3-diazacycloundeca-2,8-diene |
|---|---|
| PubChem CID | 134270499 |
| Molecular Formula | C22H38N2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | 1,4,4-trimethyl-10-[(1Z,3Z)-5-methylhexa-1,3-dienyl]-2-propyl-1,3-diazacycloundeca-2,8-diene |
| SMILES | CCC/C1=N/C(C)(C)CCCC=CC(/C=C\C=C/C(C)C)CN1C |
| InChI | InChI=1S/C22H38N2/c1-7-13-21-23-22(4,5)17-12-8-9-15-20(18-24(21)6)16-11-10-14-19(2)3/h9-11,14-16,19-20H,7-8,12-13,17-18H2,1-6H3/b14-10-,15-9?,16-11-,23-21- |
| InChIKey | MSHYCGKFXDXOPM-ARZQZLJWSA-N |
| XLogP | 6.02 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|