C23H41N3 — CID 134270603
(Z,7E)-N,5-dimethyl-7-[(5Z)-9-methyl-2-(3-methylpentyl)-1,4,8,9-tetrahydro-1,3-diazonin-7-ylidene]hept-3-en-1-amine (PubChem CID 134270603) has the molecular formula C23H41N3 and a molecular weight of 359.60 g/mol. Its IUPAC name is (Z,7E)-N,5-dimethyl-7-[(5Z)-9-methyl-2-(3-methylpentyl)-1,4,8,9-tetrahydro-1,3-diazonin-7-ylidene]hept-3-en-1-amine.
| Compound Name | (Z,7E)-N,5-dimethyl-7-[(5Z)-9-methyl-2-(3-methylpentyl)-1,4,8,9-tetrahydro-1,3-diazonin-7-ylidene]hept-3-en-1-amine |
|---|---|
| PubChem CID | 134270603 |
| Molecular Formula | C23H41N3 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.33 |
| IUPAC Name | (Z,7E)-N,5-dimethyl-7-[(5Z)-9-methyl-2-(3-methylpentyl)-1,4,8,9-tetrahydro-1,3-diazonin-7-ylidene]hept-3-en-1-amine |
| SMILES | CCC(C)CC/C1=N/C/C=C\C(=C\CC(C)/C=C\CCNC)CC(C)N1 |
| InChI | InChI=1S/C23H41N3/c1-6-19(2)13-15-23-25-17-9-11-22(18-21(4)26-23)14-12-20(3)10-7-8-16-24-5/h7,9-11,14,19-21,24H,6,8,12-13,15-18H2,1-5H3,(H,25,26)/b10-7-,11-9-,22-14- |
| InChIKey | MZLAZSMIWCJSQA-ZNQSVBKPSA-N |
| XLogP | 5.27 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|