C30H54N4 — CID 134270618
N-[3-[4-[3-[[C-ethyl-N-[(Z)-4-methylpent-2-enyl]carbonimidoyl]amino]-2-methylpropylidene]cyclohexylidene]propyl]-N',4-dimethylhexanimidamide (PubChem CID 134270618) has the molecular formula C30H54N4 and a molecular weight of 470.79 g/mol. Its IUPAC name is N-[3-[4-[3-[[C-ethyl-N-[(Z)-4-methylpent-2-enyl]carbonimidoyl]amino]-2-methylpropylidene]cyclohexylidene]propyl]-N',4-dimethylhexanimidamide.
| Compound Name | N-[3-[4-[3-[[C-ethyl-N-[(Z)-4-methylpent-2-enyl]carbonimidoyl]amino]-2-methylpropylidene]cyclohexylidene]propyl]-N',4-dimethylhexanimidamide |
|---|---|
| PubChem CID | 134270618 |
| Molecular Formula | C30H54N4 |
| Molecular Weight | 470.79 g/mol |
| Exact Mass | 470.43 |
| IUPAC Name | N-[3-[4-[3-[[C-ethyl-N-[(Z)-4-methylpent-2-enyl]carbonimidoyl]amino]-2-methylpropylidene]cyclohexylidene]propyl]-N',4-dimethylhexanimidamide |
| SMILES | CC/C(=N\C/C=C\C(C)C)NCC(C)C=C1CCC(=CCCN/C(CCC(C)CC)=N/C)CC1 |
| InChI | InChI=1S/C30H54N4/c1-8-25(5)14-19-30(31-7)33-21-11-13-27-15-17-28(18-16-27)22-26(6)23-34-29(9-2)32-20-10-12-24(3)4/h10,12-13,22,24-26H,8-9,11,14-21,23H2,1-7H3,(H,31,33)(H,32,34)/b12-10-,27-13-,28-22+ |
| InChIKey | OYPDBZSYXTUJLO-FBNUEJJMSA-N |
| XLogP | 7.49 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.79 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|