About 6-methoxy-6-methyl-2,3-dihydro-1H-inden-5-one
6-methoxy-6-methyl-2,3-dihydro-1H-inden-5-one (PubChem CID 13427083) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 6-methoxy-6-methyl-2,3-dihydro-1H-inden-5-one.
Molecular Properties
| Compound Name | 6-methoxy-6-methyl-2,3-dihydro-1H-inden-5-one |
| PubChem CID | 13427083 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 6-methoxy-6-methyl-2,3-dihydro-1H-inden-5-one |
| SMILES | COC1(C)C=C2CCCC2=CC1=O |
| InChI | InChI=1S/C11H14O2/c1-11(13-2)7-9-5-3-4-8(9)6-10(11)12/h6-7H,3-5H2,1-2H3 |
| InChIKey | GEDWNQMCZBLWTB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methoxy-6-methyl-2,3-dihydro-1H-inden-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-6-methyl-2,3-dihydro-1H-inden-5-one?
The IUPAC name of 6-methoxy-6-methyl-2,3-dihydro-1H-inden-5-one (CID 13427083) is 6-methoxy-6-methyl-2,3-dihydro-1H-inden-5-one.
What is the SMILES notation for 6-methoxy-6-methyl-2,3-dihydro-1H-inden-5-one?
The canonical SMILES for 6-methoxy-6-methyl-2,3-dihydro-1H-inden-5-one is COC1(C)C=C2CCCC2=CC1=O.
What is the InChIKey of 6-methoxy-6-methyl-2,3-dihydro-1H-inden-5-one?
The InChIKey is GEDWNQMCZBLWTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-11(13-2)7-9-5-3-4-8(9)6-10(11)12/h6-7H,3-5H2,1-2H3.
What are the key properties of 6-methoxy-6-methyl-2,3-dihydro-1H-inden-5-one?
6-methoxy-6-methyl-2,3-dihydro-1H-inden-5-one has a molecular weight of 178.23 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-6-methyl-2,3-dihydro-1H-inden-5-one is sourced from PubChem (CID 13427083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).