C16H30N4O2 — CID 134271019
(2S)-5-amino-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]-N-[(2E)-penta-2,4-dien-2-yl]pentanamide (PubChem CID 134271019) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]-N-[(2E)-penta-2,4-dien-2-yl]pentanamide.
| Compound Name | (2S)-5-amino-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]-N-[(2E)-penta-2,4-dien-2-yl]pentanamide |
|---|---|
| PubChem CID | 134271019 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | (2S)-5-amino-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]-N-[(2E)-penta-2,4-dien-2-yl]pentanamide |
| SMILES | C=C/C=C(\C)NC(=O)[C@H](CCCN)NC(=O)[C@@H](NC)C(C)C |
| InChI | InChI=1S/C16H30N4O2/c1-6-8-12(4)19-15(21)13(9-7-10-17)20-16(22)14(18-5)11(2)3/h6,8,11,13-14,18H,1,7,9-10,17H2,2-5H3,(H,19,21)(H,20,22)/b12-8+/t13-,14-/m0/s1 |
| InChIKey | OAJQBBODXLJHBR-QZKSUSQMSA-N |
| XLogP | 0.66 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|